Products 522649-59-8
CAS 522649-59-8 appears in our catalog under these names: Malic enzyme inhibitor ME1/ 99.93% (existing batch purity), Malic enzyme inhibitor ME1, Malic enzyme inhibitor Me1, 3-(4-(4-Hydroxyphenyl)piperazin-1-yl)-1-phenylpyrrolidine-2,5-dione, Malic enzyme inhibitor ME1, 99.69%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso).
3-[4-(4-hydroxyphenyl)piperazin-1-yl]-1-phenylpyrrolidine-2,5-dione (CAS 522649-59-8) is a chemical compound with the molecular formula C20H21N3O3 and a molecular weight of 351.4 g/mol. IUPAC name: 3-[4-(4-hydroxyphenyl)piperazin-1-yl]-1-phenylpyrrolidine-2,5-dione. InChIKey: JJFJQFJFFVLMCX-UHFFFAOYSA-N.
| Molecular formula | C20H21N3O3 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 3-[4-(4-hydroxyphenyl)piperazin-1-yl]-1-phenylpyrrolidine-2,5-dione |
| InChIKey | JJFJQFJFFVLMCX-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2CC(=O)N(C2=O)C3=CC=CC=C3)C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)
Synonyms:
Malic Enzyme inhibitor ME1, 3-(4-(4-hydroxyphenyl)piperazin-1-yl)-1-phenylpyrrolidine-2,5-dione, 3-[4-(4-hydroxyphenyl)piperazin-1-yl]-1-phenylpyrrolidine-2,5-dione, 4-[4-(2,5-dioxo-1-phenylpyrrolidin-3-yl)piperazin-4-ium-1-yl]phenolate, Malic Enzyme inhibitor ME1?, orb1709199, Malic Enzyme inhibitor ME1 (ME1), Malic enzyme inhibitor ME1, 10 mM in DMSO, Malic enzyme inhibitor ME1 (Synonyms: ME1), 2,5-Pyrrolidinedione, 3-[4-(4-hydroxyphenyl)-1-piperazinyl]-1-phenyl-