CAS 52298-01-8 is the registry number for Dipropyl 2-(1,3-dithiolan-2-ylidene)malonate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
6-nitro-1,2-dihydronaphtho[2,3-h][3,1]benzoxazine-4,7,12-trione (CAS 52298-01-8) is a chemical compound with the molecular formula C16H8N2O6 and a molecular weight of 324.24 g/mol. IUPAC name: 6-nitro-1,2-dihydronaphtho[2,3-h][3,1]benzoxazine-4,7,12-trione. InChIKey: RASPFILDTJZROS-UHFFFAOYSA-N.
| Molecular formula | C16H8N2O6 |
|---|---|
| Molecular weight | 324.24 g/mol |
| IUPAC name | 6-nitro-1,2-dihydronaphtho[2,3-h][3,1]benzoxazine-4,7,12-trione |
| InChIKey | RASPFILDTJZROS-UHFFFAOYSA-N |
| SMILES | C1NC2=C3C(=C(C=C2C(=O)O1)[N+](=O)[O-])C(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)