CAS 52298-02-9 is the registry number for 2H-Anthra[1,2-d][1,3]oxazine-4,7,12(1H)-trione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2-dihydronaphtho[2,3-h][3,1]benzoxazine-4,7,12-trione (CAS 52298-02-9) is a chemical compound with the molecular formula C16H9NO4 and a molecular weight of 279.25 g/mol. IUPAC name: 1,2-dihydronaphtho[2,3-h][3,1]benzoxazine-4,7,12-trione. InChIKey: AFDJWFZOHJHHGO-UHFFFAOYSA-N.
| Molecular formula | C16H9NO4 |
|---|---|
| Molecular weight | 279.25 g/mol |
| IUPAC name | 1,2-dihydronaphtho[2,3-h][3,1]benzoxazine-4,7,12-trione |
| InChIKey | AFDJWFZOHJHHGO-UHFFFAOYSA-N |
| SMILES | C1NC2=C(C=CC3=C2C(=O)C4=CC=CC=C4C3=O)C(=O)O1 |
Computed by PubChem (NCBI)