CAS 52299-24-8 appears in our catalog under these names: Perfluorobutylphosphonic Acid, >95% (HPLC), Perfluorobutylphosphonic acid. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 50mg, 25mg.
1,1,2,2,3,3,4,4,4-nonafluorobutylphosphonic acid (CAS 52299-24-8) is a chemical compound with the molecular formula C4H2F9O3P and a molecular weight of 300.02 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,4-nonafluorobutylphosphonic acid. InChIKey: AUBOIAPNLUHLAF-UHFFFAOYSA-N.
| Molecular formula | C4H2F9O3P |
|---|---|
| Molecular weight | 300.02 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,4-nonafluorobutylphosphonic acid |
| InChIKey | AUBOIAPNLUHLAF-UHFFFAOYSA-N |
| SMILES | C(C(C(F)(F)P(=O)(O)O)(F)F)(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)