CAS 523-21-7 appears in our catalog under these names: Rhodizonic acid, disodium salt/ 99+%, Rhodizonic Acid Sodium Salt, Rhodizonic acid sodium salt, 97.00%, Disodium Rhodizonate, >90.0%(T), Sodium rhodizonate dibasic. Offered by: Chemat, GLPBio, TCI, Biosynth, MedChemExpress. Available pack sizes: 100g, 25g, 1g, 5g, 50g, 250g, 500g, 25 g.
Disodium;3,4,5,6-tetraoxocyclohexene-1,2-diolate (CAS 523-21-7) is a chemical compound with the molecular formula C6Na2O6 and a molecular weight of 214.04 g/mol. IUPAC name: disodium;3,4,5,6-tetraoxocyclohexene-1,2-diolate. InChIKey: SXWPCWBFJXDMAI-UHFFFAOYSA-L.
| Molecular formula | C6Na2O6 |
|---|---|
| Molecular weight | 214.04 g/mol |
| IUPAC name | disodium;3,4,5,6-tetraoxocyclohexene-1,2-diolate |
| InChIKey | SXWPCWBFJXDMAI-UHFFFAOYSA-L |
| SMILES | C1(=C(C(=O)C(=O)C(=O)C1=O)[O-])[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)