Products 523-88-6
CAS 523-88-6 is the registry number for Dibromsalicil. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,2-bis(5-bromo-2-hydroxyphenyl)ethane-1,2-dione (CAS 523-88-6) is a chemical compound with the molecular formula C14H8Br2O4 and a molecular weight of 400.02 g/mol. IUPAC name: 1,2-bis(5-bromo-2-hydroxyphenyl)ethane-1,2-dione. InChIKey: AAOYLOCWJSLLJU-UHFFFAOYSA-N.
| Molecular formula | C14H8Br2O4 |
|---|---|
| Molecular weight | 400.02 g/mol |
| IUPAC name | 1,2-bis(5-bromo-2-hydroxyphenyl)ethane-1,2-dione |
| InChIKey | AAOYLOCWJSLLJU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(=O)C(=O)C2=C(C=CC(=C2)Br)O)O |
Computed by PubChem (NCBI)