CAS 52313-61-8 is the registry number for 2-Chloro-4-methylpyridine 1-oxide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-chloro-4-methyl-1-oxidopyridin-1-ium (CAS 52313-61-8) is a chemical compound with the molecular formula C6H6ClNO and a molecular weight of 143.57 g/mol. IUPAC name: 2-chloro-4-methyl-1-oxidopyridin-1-ium. InChIKey: CTRINZIZOOSLLD-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO |
|---|---|
| Molecular weight | 143.57 g/mol |
| IUPAC name | 2-chloro-4-methyl-1-oxidopyridin-1-ium |
| InChIKey | CTRINZIZOOSLLD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=[N+](C=C1)[O-])Cl |
Computed by PubChem (NCBI)