CAS 52328-05-9 appears in our catalog under these names: O-Methylisourea Hemisulfate, >95% (HPLC), O–Methylisourea Sulfate, O-Methylisourea hemisulfate, 99% , O-Methylisourea hemisulfate salt , 98.00%, O-Methylisourea Sulfate, >98.0%(N). Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Chemat, TCI. Available pack sizes: 5g, 500g, 1000g, 50g, 250g, 100g, 25g, 10g.
Methyl carbamimidate;sulfuric acid (CAS 52328-05-9) is a chemical compound with the molecular formula C4H14N4O6S and a molecular weight of 246.25 g/mol. IUPAC name: methyl carbamimidate;sulfuric acid. InChIKey: QSCPQKVWSNUJLJ-UHFFFAOYSA-N.
| Molecular formula | C4H14N4O6S |
|---|---|
| Molecular weight | 246.25 g/mol |
| IUPAC name | methyl carbamimidate;sulfuric acid |
| InChIKey | QSCPQKVWSNUJLJ-UHFFFAOYSA-N |
| SMILES | COC(=N)N.COC(=N)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)