CAS 5233-42-1 appears in our catalog under these names: 5–chloro Hydrochlorothiazide, 5-Chloro Hydrochlorothiazide, 5-Chloro Hydrochlorothiazide, >95% (HPLC), 5-Chlorohydrochlorothiazide, 5-chloro Hydrochlorothiazide 97%. Offered by: GLPBio, Chemat Brand, TRC, Mikromol, TargetMol. Available pack sizes: 1mg, on request, 10mg, 25mg, 50mg, 5mg, 100mg, 250mg.
5,6-dichloro-1,1-dioxo-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-7-sulfonamide (CAS 5233-42-1) is a chemical compound with the molecular formula C7H7Cl2N3O4S2 and a molecular weight of 332.2 g/mol. IUPAC name: 5,6-dichloro-1,1-dioxo-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-7-sulfonamide. InChIKey: BSNKBIJVLZUERH-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2N3O4S2 |
|---|---|
| Molecular weight | 332.2 g/mol |
| IUPAC name | 5,6-dichloro-1,1-dioxo-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-7-sulfonamide |
| InChIKey | BSNKBIJVLZUERH-UHFFFAOYSA-N |
| SMILES | C1NC2=C(C(=C(C=C2S(=O)(=O)N1)S(=O)(=O)N)Cl)Cl |
Computed by PubChem (NCBI)