CAS 52334-38-0 appears in our catalog under these names: 2-Phenyl-thiazolo[5,4-c]pyridine, 95%, 2–Phenylthiazolo(5,4–c)pyridine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 250mg, 100mg.
2-phenyl-[1,3]thiazolo[5,4-c]pyridine (CAS 52334-38-0) is a chemical compound with the molecular formula C12H8N2S and a molecular weight of 212.27 g/mol. IUPAC name: 2-phenyl-[1,3]thiazolo[5,4-c]pyridine. InChIKey: ZSZZNJHWTPTBJG-UHFFFAOYSA-N.
| Molecular formula | C12H8N2S |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | 2-phenyl-[1,3]thiazolo[5,4-c]pyridine |
| InChIKey | ZSZZNJHWTPTBJG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(S2)C=NC=C3 |
Computed by PubChem (NCBI)