CAS 52350-17-1 is the registry number for Cesium tungsten oxide, 99.9 %. Offered by: Chemat Brand. Available pack sizes: on request.
Dicesium;dioxido(dioxo)tungsten (CAS 52350-17-1) is a chemical compound with the molecular formula Cs2O4W and a molecular weight of 513.65 g/mol. IUPAC name: dicesium;dioxido(dioxo)tungsten. InChIKey: VPXSRGLTQINCRV-UHFFFAOYSA-N.
| Molecular formula | Cs2O4W |
|---|---|
| Molecular weight | 513.65 g/mol |
| IUPAC name | dicesium;dioxido(dioxo)tungsten |
| InChIKey | VPXSRGLTQINCRV-UHFFFAOYSA-N |
| SMILES | [O-][W](=O)(=O)[O-].[Cs+].[Cs+] |
Computed by PubChem (NCBI)