CAS 52351-76-5 is the registry number for (2,3-Dihydrobenzo[b][1,4]dioxin-6-yl)trimethylsilane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3-dihydro-1,4-benzodioxin-6-yl(trimethyl)silane (CAS 52351-76-5) is a chemical compound with the molecular formula C11H16O2Si and a molecular weight of 208.33 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxin-6-yl(trimethyl)silane. InChIKey: XIHKRVGLNCANGP-UHFFFAOYSA-N.
| Molecular formula | C11H16O2Si |
|---|---|
| Molecular weight | 208.33 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxin-6-yl(trimethyl)silane |
| InChIKey | XIHKRVGLNCANGP-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=CC2=C(C=C1)OCCO2 |
Computed by PubChem (NCBI)