CAS 52359-16-7 is the registry number for Bis[tris(1-methylethyl)phosphine]palladium, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Palladium;bis(tri(propan-2-yl)phosphanium) (CAS 52359-16-7) is a chemical compound with the molecular formula C18H44P2Pd+2 and a molecular weight of 428.9 g/mol. IUPAC name: palladium;bis(tri(propan-2-yl)phosphanium). InChIKey: NFUIQPSPUZQLSB-UHFFFAOYSA-P.
| Molecular formula | C18H44P2Pd+2 |
|---|---|
| Molecular weight | 428.9 g/mol |
| IUPAC name | palladium;bis(tri(propan-2-yl)phosphanium) |
| InChIKey | NFUIQPSPUZQLSB-UHFFFAOYSA-P |
| SMILES | CC(C)[PH+](C(C)C)C(C)C.CC(C)[PH+](C(C)C)C(C)C.[Pd] |
Computed by PubChem (NCBI)