Products 52369-61-6

CAS 52369-61-6 is the registry number for 2-[(2-Methylpropyl)sulfanyl]benzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.

Structural formula: {0} (CAS {1})

2-(2-methylpropylsulfanyl)benzoic acid (CAS 52369-61-6) is a chemical compound with the molecular formula C11H14O2S and a molecular weight of 210.29 g/mol. IUPAC name: 2-(2-methylpropylsulfanyl)benzoic acid. InChIKey: JYJZOPWGIOPLTC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14O2S
Molecular weight210.29 g/mol
IUPAC name2-(2-methylpropylsulfanyl)benzoic acid
InChIKeyJYJZOPWGIOPLTC-UHFFFAOYSA-N
SMILESCC(C)CSC1=CC=CC=C1C(=O)O

Computed by PubChem (NCBI)