CAS 52379-26-7 is the registry number for 4-(1,3-Dimethyl-1,3-diphenylbutyl)phenol, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.
4-(4-methyl-2,4-diphenylpentan-2-yl)phenol (CAS 52379-26-7) is a chemical compound with the molecular formula C24H26O and a molecular weight of 330.5 g/mol. IUPAC name: 4-(4-methyl-2,4-diphenylpentan-2-yl)phenol. InChIKey: STZSHXNQDPAUAK-UHFFFAOYSA-N.
| Molecular formula | C24H26O |
|---|---|
| Molecular weight | 330.5 g/mol |
| IUPAC name | 4-(4-methyl-2,4-diphenylpentan-2-yl)phenol |
| InChIKey | STZSHXNQDPAUAK-UHFFFAOYSA-N |
| SMILES | CC(C)(CC(C)(C1=CC=CC=C1)C2=CC=C(C=C2)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)