CAS 524-63-0 appears in our catalog under these names: O-Desmethyl Quinine, (8α,9R)–Cinchonan–6',9–diol, O-Desmethyl Quinine 98%, 4-((R)-Hydroxy((1S,2S,4S,5R)-5-vinylquinuclidin-2-yl)methyl)quinolin-6-ol, 97% (with 5-10% cinchonidine), 97% (with 5-10% cinchonidine), O-Desmethyl Quinine, 97% (with 5-10% cinchonidine). Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 1mg, 25mg, 100mg, 1g, 250mg, 5g, 0,25g.
4-[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-hydroxymethyl]quinolin-6-ol (CAS 524-63-0) is a chemical compound with the molecular formula C19H22N2O2 and a molecular weight of 310.4 g/mol. IUPAC name: 4-[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-hydroxymethyl]quinolin-6-ol. InChIKey: VJFMSYZSFUWQPZ-BIPCEHGGSA-N.
| Molecular formula | C19H22N2O2 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 4-[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-hydroxymethyl]quinolin-6-ol |
| InChIKey | VJFMSYZSFUWQPZ-BIPCEHGGSA-N |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@@H](C3=C4C=C(C=CC4=NC=C3)O)O |
Computed by PubChem (NCBI)