CAS 524033-98-5 appears in our catalog under these names: (2-Nitro-5-piperazin-1-ylphenyl)(tetrahydrofuran-2-ylmethyl)amine hydrochloride, 95%, 2-Nitro-5-(piperazin-1-yl)-N-((tetrahydrofuran-2-yl)methyl)aniline, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-nitro-N-(oxolan-2-ylmethyl)-5-piperazin-1-ylaniline (CAS 524033-98-5) is a chemical compound with the molecular formula C15H22N4O3 and a molecular weight of 306.36 g/mol. IUPAC name: 2-nitro-N-(oxolan-2-ylmethyl)-5-piperazin-1-ylaniline. InChIKey: NBQUAKXLTFLOAI-UHFFFAOYSA-N.
| Molecular formula | C15H22N4O3 |
|---|---|
| Molecular weight | 306.36 g/mol |
| IUPAC name | 2-nitro-N-(oxolan-2-ylmethyl)-5-piperazin-1-ylaniline |
| InChIKey | NBQUAKXLTFLOAI-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)CNC2=C(C=CC(=C2)N3CCNCC3)[N+](=O)[O-] |
Computed by PubChem (NCBI)