Products 524057-23-6
CAS 524057-23-6 is the registry number for N-(2-Bromophenyl)-n'-(4,6-dimethylpyrimidin-2-yl)guanidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(2-bromophenyl)-2-(4,6-dimethylpyrimidin-2-yl)guanidine (CAS 524057-23-6) is a chemical compound with the molecular formula C13H14BrN5 and a molecular weight of 320.19 g/mol. IUPAC name: 1-(2-bromophenyl)-2-(4,6-dimethylpyrimidin-2-yl)guanidine. InChIKey: VUQGDXUZBOTLAN-UHFFFAOYSA-N.
| Molecular formula | C13H14BrN5 |
|---|---|
| Molecular weight | 320.19 g/mol |
| IUPAC name | 1-(2-bromophenyl)-2-(4,6-dimethylpyrimidin-2-yl)guanidine |
| InChIKey | VUQGDXUZBOTLAN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)/N=C(\N)/NC2=CC=CC=C2Br)C |
Computed by PubChem (NCBI)