CAS 5241-22-5 is the registry number for Methost-8-enol. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 5mg, 10mg, 25mg.
4alpha-methyl-5alpha-cholest-8-en-3beta-ol is a 3beta-sterol that is 5alpha-cholest-8-en-3beta-ol carrying an additional methyl substituent at position 4alpha. It has a role as a human metabolite. It is a 3beta-sterol and a cholestanoid.
Source: ChEBI
| Molecular formula | C28H48O |
|---|---|
| Molecular weight | 400.7 g/mol |
| IUPAC name | (3S,4S,5S,10S,13R,14R,17R)-4,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| InChIKey | SCEZIHJVTBQOLS-YIJYGBTNSA-N |
| SMILES | C[C@H]1[C@@H]2CCC3=C([C@]2(CC[C@@H]1O)C)CC[C@]4([C@H]3CC[C@@H]4[C@H](C)CCCC(C)C)C |
Computed by PubChem (NCBI)