CAS 52434-90-9 appears in our catalog under these names: 1,3,5-Tris(2,3-dibromopropyl) Isocyanurate, >95% (HPLC), Tris(2,3-dibromopropyl) isocyanurate, Tris(2,3–dibromopropyl) Isocyanurate, Tris(2,3-dibromopropyl) isocyanurate, 97% , Tris(2,3-dibromopropyl) Isocyanurate, >97.0%(T). Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 10g, 1g, 50g, 100mg, 100g, 500g, 25g.
1,3,5-tris(2,3-dibromopropyl)-1,3,5-triazinane-2,4,6-trione (CAS 52434-90-9) is a chemical compound with the molecular formula C12H15Br6N3O3 and a molecular weight of 728.7 g/mol. IUPAC name: 1,3,5-tris(2,3-dibromopropyl)-1,3,5-triazinane-2,4,6-trione. InChIKey: NZUPFZNVGSWLQC-UHFFFAOYSA-N.
| Molecular formula | C12H15Br6N3O3 |
|---|---|
| Molecular weight | 728.7 g/mol |
| IUPAC name | 1,3,5-tris(2,3-dibromopropyl)-1,3,5-triazinane-2,4,6-trione |
| InChIKey | NZUPFZNVGSWLQC-UHFFFAOYSA-N |
| SMILES | C(C(CBr)Br)N1C(=O)N(C(=O)N(C1=O)CC(CBr)Br)CC(CBr)Br |
Computed by PubChem (NCBI)