CAS 52443-07-9 appears in our catalog under these names: 2,3,4,6-Tetra-o-acetyl-beta-d-galactopyranosyl cyanide, 95%, (2R,3S,4R,5S,6S)–2–(acetoxymethyl)–6–cyanotetrahydro–2H–pyran–3,4,5–triyl triacetate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
[(2R,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-cyanooxan-2-yl]methyl acetate (CAS 52443-07-9) is a chemical compound with the molecular formula C15H19NO9 and a molecular weight of 357.31 g/mol. IUPAC name: [(2R,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-cyanooxan-2-yl]methyl acetate. InChIKey: URSBDPDTERVBDN-AIEDFZFUSA-N.
| Molecular formula | C15H19NO9 |
|---|---|
| Molecular weight | 357.31 g/mol |
| IUPAC name | [(2R,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-cyanooxan-2-yl]methyl acetate |
| InChIKey | URSBDPDTERVBDN-AIEDFZFUSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)C#N)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)