Products 52447-22-0

CAS 52447-22-0 appears in our catalog under these names: Perfluoroheptanoyl chloride, 95%, Perfluoroheptanoyl chloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 25g, 5g, 1g, 10g, 50g.

Structural formula: {0} (CAS {1})

2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl chloride (CAS 52447-22-0) is a chemical compound with the molecular formula C7ClF13O and a molecular weight of 382.50 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl chloride. InChIKey: IAHVCTQMGIVZJU-UHFFFAOYSA-N.

Identity
Molecular formulaC7ClF13O
Molecular weight382.50 g/mol
IUPAC name2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl chloride
InChIKeyIAHVCTQMGIVZJU-UHFFFAOYSA-N
SMILESC(=O)(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)Cl

Computed by PubChem (NCBI)