CAS 52447-22-0 appears in our catalog under these names: Perfluoroheptanoyl chloride, 95%, Perfluoroheptanoyl chloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 25g, 5g, 1g, 10g, 50g.
2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl chloride (CAS 52447-22-0) is a chemical compound with the molecular formula C7ClF13O and a molecular weight of 382.50 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl chloride. InChIKey: IAHVCTQMGIVZJU-UHFFFAOYSA-N.
| Molecular formula | C7ClF13O |
|---|---|
| Molecular weight | 382.50 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl chloride |
| InChIKey | IAHVCTQMGIVZJU-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)Cl |
Computed by PubChem (NCBI)