CAS 52447-23-1 appears in our catalog under these names: Perfluorononanoyl chloride, 95%, Heptadecafluorononanoyl chloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 100g, 25g, 5g.
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoyl chloride (CAS 52447-23-1) is a chemical compound with the molecular formula C9ClF17O and a molecular weight of 482.52 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoyl chloride. InChIKey: MPWXHQITWLFMQM-UHFFFAOYSA-N.
| Molecular formula | C9ClF17O |
|---|---|
| Molecular weight | 482.52 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoyl chloride |
| InChIKey | MPWXHQITWLFMQM-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)Cl |
Computed by PubChem (NCBI)