CAS 52454-37-2 appears in our catalog under these names: Pralatrexate Impurity 7, 10-Deazaminopterin, 10-Deazaaminopterin. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 100mg, 25mg, 50mg, Get quote.
(2S)-2-[[4-[2-(2,4-diaminopteridin-6-yl)ethyl]benzoyl]amino]pentanedioic acid (CAS 52454-37-2) is a chemical compound with the molecular formula C20H21N7O5 and a molecular weight of 439.4 g/mol. IUPAC name: (2S)-2-[[4-[2-(2,4-diaminopteridin-6-yl)ethyl]benzoyl]amino]pentanedioic acid. InChIKey: LGFLRHWJJKLPCC-ZDUSSCGKSA-N.
| Molecular formula | C20H21N7O5 |
|---|---|
| Molecular weight | 439.4 g/mol |
| IUPAC name | (2S)-2-[[4-[2-(2,4-diaminopteridin-6-yl)ethyl]benzoyl]amino]pentanedioic acid |
| InChIKey | LGFLRHWJJKLPCC-ZDUSSCGKSA-N |
| SMILES | C1=CC(=CC=C1CCC2=CN=C3C(=N2)C(=NC(=N3)N)N)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)