CAS 524746-11-0 is the registry number for 3-Hydroxy Deferasirox(Metabolite M2). Offered by: TRC. Available pack sizes: 10mg.
4-[3-(2,3-dihydroxyphenyl)-5-(2-hydroxyphenyl)-1,2,4-triazol-1-yl]benzoic acid (CAS 524746-11-0) is a chemical compound with the molecular formula C21H15N3O5 and a molecular weight of 389.4 g/mol. IUPAC name: 4-[3-(2,3-dihydroxyphenyl)-5-(2-hydroxyphenyl)-1,2,4-triazol-1-yl]benzoic acid. InChIKey: QFPKPGGFQPKEHD-UHFFFAOYSA-N.
| Molecular formula | C21H15N3O5 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | 4-[3-(2,3-dihydroxyphenyl)-5-(2-hydroxyphenyl)-1,2,4-triazol-1-yl]benzoic acid |
| InChIKey | QFPKPGGFQPKEHD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=NN2C3=CC=C(C=C3)C(=O)O)C4=C(C(=CC=C4)O)O)O |
Computed by PubChem (NCBI)