CAS 52481-90-0 appears in our catalog under these names: 2,5-Dimethylquinolin-4(1H)-one, 97%, 2,5-Dimethyl-1,4-dihydroquinolin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2,5-dimethyl-1H-quinolin-4-one (CAS 52481-90-0) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 2,5-dimethyl-1H-quinolin-4-one. InChIKey: DSOBBWSUYIYTLE-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 2,5-dimethyl-1H-quinolin-4-one |
| InChIKey | DSOBBWSUYIYTLE-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)NC(=CC2=O)C |
Computed by PubChem (NCBI)