CAS 524928-16-3 is the registry number for 2-Cyano-n-[1-(3,4-dimethylphenyl)ethyl]acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-cyano-N-[1-(3,4-dimethylphenyl)ethyl]acetamide (CAS 524928-16-3) is a chemical compound with the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. IUPAC name: 2-cyano-N-[1-(3,4-dimethylphenyl)ethyl]acetamide. InChIKey: LXNVONRWILNRJK-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | 2-cyano-N-[1-(3,4-dimethylphenyl)ethyl]acetamide |
| InChIKey | LXNVONRWILNRJK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(C)NC(=O)CC#N)C |
Computed by PubChem (NCBI)