CAS 5250-72-6 appears in our catalog under these names: 4-Amino-5,6-dichloro-1,3-benzenedisulfonamide, 4-Amino-5,6-dichlorobenzene-1,3-disulfonamide, 4-Amino-5,6-dichlorobenzene-1,3-disulfonamide, 97%, 97%, 4-Amino-5,6-dichlorobenzene-1,3-disulfonamide, 97%. Offered by: TRC, Mikromol, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 25mg, 250mg, 100mg, 5g.
4-amino-5,6-dichlorobenzene-1,3-disulfonamide (CAS 5250-72-6) is a chemical compound with the molecular formula C6H7Cl2N3O4S2 and a molecular weight of 320.2 g/mol. IUPAC name: 4-amino-5,6-dichlorobenzene-1,3-disulfonamide. InChIKey: DNBXGTICJYDFDT-UHFFFAOYSA-N.
| Molecular formula | C6H7Cl2N3O4S2 |
|---|---|
| Molecular weight | 320.2 g/mol |
| IUPAC name | 4-amino-5,6-dichlorobenzene-1,3-disulfonamide |
| InChIKey | DNBXGTICJYDFDT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1S(=O)(=O)N)Cl)Cl)N)S(=O)(=O)N |
Computed by PubChem (NCBI)