CAS 52508-35-7 appears in our catalog under these names: Dikegulac sodium, 95%, Dikegulac sodium, Dikegulac sodium 10 µg/mL in Acetonitrile, Dikegulac sodium 100 µg/mL in Acetonitrile:Water, 2,3:4,6-Di-O-isopropylidene-2-keto-L-gulonic acid sodium salt. Offered by: Combi-blocks, Dr. Ehrenstorfer, Biosynth, HPC Standards. Available pack sizes: 5g, 500g, 25g, 100g, 1g, 250mg, 10ml, 5ml.
Sodium (1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-6-carboxylate (CAS 52508-35-7) is a chemical compound with the molecular formula C12H17NaO7 and a molecular weight of 296.25 g/mol. IUPAC name: sodium (1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-6-carboxylate. InChIKey: DEWVPZYHFVYXMZ-QCILGFJPSA-M.
| Molecular formula | C12H17NaO7 |
|---|---|
| Molecular weight | 296.25 g/mol |
| IUPAC name | sodium (1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-6-carboxylate |
| InChIKey | DEWVPZYHFVYXMZ-QCILGFJPSA-M |
| SMILES | CC1(OC[C@H]2[C@@H](O1)[C@H]3[C@@](O2)(OC(O3)(C)C)C(=O)[O-])C.[Na+] |
Computed by PubChem (NCBI)