CAS 52523-35-0 appears in our catalog under these names: Azacitidine Impurity 48, N-(Trimethylsilyl)-4-[(trimethylsilyl)oxy]-1,3,5-triazin-2-amine, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g.
N-trimethylsilyl-4-trimethylsilyloxy-1,3,5-triazin-2-amine (CAS 52523-35-0) is a chemical compound with the molecular formula C9H20N4OSi2 and a molecular weight of 256.45 g/mol. IUPAC name: N-trimethylsilyl-4-trimethylsilyloxy-1,3,5-triazin-2-amine. InChIKey: DPOVLFLVTXSCRO-UHFFFAOYSA-N.
| Molecular formula | C9H20N4OSi2 |
|---|---|
| Molecular weight | 256.45 g/mol |
| IUPAC name | N-trimethylsilyl-4-trimethylsilyloxy-1,3,5-triazin-2-amine |
| InChIKey | DPOVLFLVTXSCRO-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)NC1=NC(=NC=N1)O[Si](C)(C)C |
Computed by PubChem (NCBI)