CAS 525560-81-0 is the registry number for BTBCT. Offered by: Chemat, MedChemExpress. Available pack sizes: 250mg, 50mg, 5mg, Get quote.
3,4-bis[4-(4,4,4-trifluoro-3-oxobutanoyl)phenyl]benzenesulfonyl chloride (CAS 525560-81-0) is a chemical compound with the molecular formula C26H15ClF6O6S and a molecular weight of 604.9 g/mol. IUPAC name: 3,4-bis[4-(4,4,4-trifluoro-3-oxobutanoyl)phenyl]benzenesulfonyl chloride. InChIKey: CJRMAUPUOUJYMF-UHFFFAOYSA-N.
| Molecular formula | C26H15ClF6O6S |
|---|---|
| Molecular weight | 604.9 g/mol |
| IUPAC name | 3,4-bis[4-(4,4,4-trifluoro-3-oxobutanoyl)phenyl]benzenesulfonyl chloride |
| InChIKey | CJRMAUPUOUJYMF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=C(C=C2)S(=O)(=O)Cl)C3=CC=C(C=C3)C(=O)CC(=O)C(F)(F)F)C(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)