CAS 52591-27-2 appears in our catalog under these names: 2-(Perfluorobutyl)ethyl acrylate, 98%, 2-(Perfluorobutyl)ethyl acrylate, 97%, 2-(Perfluorobutyl)ethyl Acrylate, >95% (GC), 3,3,4,4,5,5,6,6,6-Nonafluorohexyl acrylate, 98%, 3,3,4,4,5,5,6,6,6–Nonafluorohexyl acrylate. Offered by: Combi-blocks, Fluorochem, TRC, AmBeed, GLPBio. Available pack sizes: 100g, 5g, 25g, 1g, 10g, 50g, 250g.
3,3,4,4,5,5,6,6,6-nonafluorohexyl prop-2-enoate (CAS 52591-27-2) is a chemical compound with the molecular formula C9H7F9O2 and a molecular weight of 318.14 g/mol. IUPAC name: 3,3,4,4,5,5,6,6,6-nonafluorohexyl prop-2-enoate. InChIKey: GYUPEJSTJSFVRR-UHFFFAOYSA-N.
| Molecular formula | C9H7F9O2 |
|---|---|
| Molecular weight | 318.14 g/mol |
| IUPAC name | 3,3,4,4,5,5,6,6,6-nonafluorohexyl prop-2-enoate |
| InChIKey | GYUPEJSTJSFVRR-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCCC(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)