CAS 5261-50-7 appears in our catalog under these names: 1-(Chloromethyl)-4-methylnaphthalene, 95+%, 1-Chloromethyl-4-methylnaphthalene. Offered by: AmBeed, Fluorochem. Available pack sizes: 25g, 5g, 1g.
1-(chloromethyl)-4-methylnaphthalene (CAS 5261-50-7) is a chemical compound with the molecular formula C12H11Cl and a molecular weight of 190.67 g/mol. IUPAC name: 1-(chloromethyl)-4-methylnaphthalene. InChIKey: QHXSBKTZBDHBKF-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl |
|---|---|
| Molecular weight | 190.67 g/mol |
| IUPAC name | 1-(chloromethyl)-4-methylnaphthalene |
| InChIKey | QHXSBKTZBDHBKF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C2=CC=CC=C12)CCl |
Computed by PubChem (NCBI)