Products 5261-99-4

CAS 5261-99-4 is the registry number for Levocarnitine Impurity 30. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(5-amino-3-hydroxy-5-oxopentylidene)-dimethylazanium chloride (CAS 5261-99-4) is a chemical compound with the molecular formula C7H15ClN2O2 and a molecular weight of 194.66 g/mol. IUPAC name: (5-amino-3-hydroxy-5-oxopentylidene)-dimethylazanium chloride. InChIKey: LTELZMDSXFWIGP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H15ClN2O2
Molecular weight194.66 g/mol
IUPAC name(5-amino-3-hydroxy-5-oxopentylidene)-dimethylazanium chloride
InChIKeyLTELZMDSXFWIGP-UHFFFAOYSA-N
SMILESC[N+](=CCC(CC(=O)N)O)C.[Cl-]

Computed by PubChem (NCBI)