CAS 5261-99-4 is the registry number for Levocarnitine Impurity 30. Offered by: Chemat Brand. Available pack sizes: on request.
(5-amino-3-hydroxy-5-oxopentylidene)-dimethylazanium chloride (CAS 5261-99-4) is a chemical compound with the molecular formula C7H15ClN2O2 and a molecular weight of 194.66 g/mol. IUPAC name: (5-amino-3-hydroxy-5-oxopentylidene)-dimethylazanium chloride. InChIKey: LTELZMDSXFWIGP-UHFFFAOYSA-N.
| Molecular formula | C7H15ClN2O2 |
|---|---|
| Molecular weight | 194.66 g/mol |
| IUPAC name | (5-amino-3-hydroxy-5-oxopentylidene)-dimethylazanium chloride |
| InChIKey | LTELZMDSXFWIGP-UHFFFAOYSA-N |
| SMILES | C[N+](=CCC(CC(=O)N)O)C.[Cl-] |
Computed by PubChem (NCBI)