Products 52615-97-1
CAS 52615-97-1 appears in our catalog under these names: H-Asp(OBzl)-OtBu·HCl, 97%, H–Asp(Obzl)–OtBu·HCl, H-Asp(Obzl)-OtBu.HCl, H-Asp(Obzl)-OtBu.HCl, 96%, 96%, H-Asp(Obzl)-OtBu.HCl, 99.99%. Offered by: Ambeed, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1g, 25 g, 100 g.
4-O-benzyl 1-O-tert-butyl (2S)-2-aminobutanedioate;hydrochloride (CAS 52615-97-1) is a chemical compound with the molecular formula C15H22ClNO4 and a molecular weight of 315.79 g/mol. IUPAC name: 4-O-benzyl 1-O-tert-butyl (2S)-2-aminobutanedioate;hydrochloride. InChIKey: YSDLFDMXCRFHTQ-YDALLXLXSA-N.
| Molecular formula | C15H22ClNO4 |
|---|---|
| Molecular weight | 315.79 g/mol |
| IUPAC name | 4-O-benzyl 1-O-tert-butyl (2S)-2-aminobutanedioate;hydrochloride |
| InChIKey | YSDLFDMXCRFHTQ-YDALLXLXSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CC(=O)OCC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
H-Asp(Obzl)-OtBu.HCl, (S)-4-Benzyl 1-tert-butyl 2-aminosuccinate hydrochloride, C15H22ClNO4, 4-O-benzyl 1-O-tert-butyl (2S)-2-aminobutanedioate;hydrochloride, H-ASP(OBZL)-OTBU HCL, 4-Benzyl 1-tert-Butyl (S)-2-Aminosuccinate Hydrochloride, 4-O-benzyl 1-O-tert-butyl (2S)-2-aminobutanedioate, H-Asp(OBzl)-OtBu hydrochloride, 4-Benzyl 1-(tert-butyl) L-aspartate hydrochloride, H-Asp(Obzl)-OtBu inverted exclamation mark currencyHCl