Products 52634-65-8
CAS 52634-65-8 is the registry number for (2S)-2-({(2-(4-Methoxyphenyl)ethyl)carbamoyl}amino)-3-methylbutanoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
(2S)-2-[2-(4-methoxyphenyl)ethylcarbamoylamino]-3-methylbutanoic acid (CAS 52634-65-8) is a chemical compound with the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. IUPAC name: (2S)-2-[2-(4-methoxyphenyl)ethylcarbamoylamino]-3-methylbutanoic acid. InChIKey: ZWVDGVZGVCLMGO-ZDUSSCGKSA-N.
| Molecular formula | C15H22N2O4 |
|---|---|
| Molecular weight | 294.35 g/mol |
| IUPAC name | (2S)-2-[2-(4-methoxyphenyl)ethylcarbamoylamino]-3-methylbutanoic acid |
| InChIKey | ZWVDGVZGVCLMGO-ZDUSSCGKSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NC(=O)NCCC1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)