CAS 52648-05-2 is the registry number for (6-Methylheptyl)triphenylphosphonium Bromide. Offered by: TRC. Available pack sizes: 500mg.
6-methylheptyl(triphenyl)phosphanium bromide (CAS 52648-05-2) is a chemical compound with the molecular formula C26H32BrP and a molecular weight of 455.4 g/mol. IUPAC name: 6-methylheptyl(triphenyl)phosphanium bromide. InChIKey: SJCOJGVMQVSKOJ-UHFFFAOYSA-M.
| Molecular formula | C26H32BrP |
|---|---|
| Molecular weight | 455.4 g/mol |
| IUPAC name | 6-methylheptyl(triphenyl)phosphanium bromide |
| InChIKey | SJCOJGVMQVSKOJ-UHFFFAOYSA-M |
| SMILES | CC(C)CCCCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)