CAS 5266-20-6 appears in our catalog under these names: Lithium Orotate, Lithium orotate monohydrate, Lithium 2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylate 95%, Lithium orotate, 99.57%. Offered by: Chemat Brand, Biosynth, Ambeed, MedChemExpress. Available pack sizes: on request, 1kg, 2kg, 5kg, 10kg, 250mg, 1g, 5g.
Lithium 2,4-dioxo-1H-pyrimidine-6-carboxylate (CAS 5266-20-6) is a chemical compound with the molecular formula C5H3LiN2O4 and a molecular weight of 162.1 g/mol. IUPAC name: lithium 2,4-dioxo-1H-pyrimidine-6-carboxylate. InChIKey: IZJGDPULXXNWJP-UHFFFAOYSA-M.
| Molecular formula | C5H3LiN2O4 |
|---|---|
| Molecular weight | 162.1 g/mol |
| IUPAC name | lithium 2,4-dioxo-1H-pyrimidine-6-carboxylate |
| InChIKey | IZJGDPULXXNWJP-UHFFFAOYSA-M |
| SMILES | [Li+].C1=C(NC(=O)NC1=O)C(=O)[O-] |
Computed by PubChem (NCBI)