CAS 52663-66-8 is the registry number for PCB 130, ROTI®Star, 5 mg, glass. Offered by: Roth. Available pack sizes: 5mg.
1,2,3-trichloro-4-(2,3,5-trichlorophenyl)benzene (CAS 52663-66-8) is a chemical compound with the molecular formula C12H4Cl6 and a molecular weight of 360.9 g/mol. IUPAC name: 1,2,3-trichloro-4-(2,3,5-trichlorophenyl)benzene. InChIKey: YFSLABAYQDPWPF-UHFFFAOYSA-N.
| Molecular formula | C12H4Cl6 |
|---|---|
| Molecular weight | 360.9 g/mol |
| IUPAC name | 1,2,3-trichloro-4-(2,3,5-trichlorophenyl)benzene |
| InChIKey | YFSLABAYQDPWPF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C2=C(C(=CC(=C2)Cl)Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)