CAS 52663-77-1 is the registry number for PCB No. 208 10 µg/mL in Isooctane. Offered by: Dr. Ehrenstorfer. Available pack sizes: 10ml.
1,2,3,4,5-pentachloro-6-(2,3,5,6-tetrachlorophenyl)benzene (CAS 52663-77-1) is a chemical compound with the molecular formula C12HCl9 and a molecular weight of 464.2 g/mol. IUPAC name: 1,2,3,4,5-pentachloro-6-(2,3,5,6-tetrachlorophenyl)benzene. InChIKey: XIFFTDRFWYFAPO-UHFFFAOYSA-N.
| Molecular formula | C12HCl9 |
|---|---|
| Molecular weight | 464.2 g/mol |
| IUPAC name | 1,2,3,4,5-pentachloro-6-(2,3,5,6-tetrachlorophenyl)benzene |
| InChIKey | XIFFTDRFWYFAPO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)Cl)C2=C(C(=C(C(=C2Cl)Cl)Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)