CAS 52667-89-7 appears in our catalog under these names: 1,4,7-Tritosyl-1,4,7-triazonane, 97%, 1,4,7–Tris((4–Methylphenyl)Sulfonyl)–1,4,7–Triazonane, 1,4,7-Tritosyl-1,4,7-triazonane 97%, 1,4,7-Tritosyl-1,4,7-triazonane, 97%, 97%, 1,4,7-Tri(p-tolylsulfonyl)-1,4,7-triazacyclononane, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 25g.
1,4,7-tris-(4-methylphenyl)sulfonyl-1,4,7-triazonane (CAS 52667-89-7) is a chemical compound with the molecular formula C27H33N3O6S3 and a molecular weight of 591.8 g/mol. IUPAC name: 1,4,7-tris-(4-methylphenyl)sulfonyl-1,4,7-triazonane. InChIKey: BLZOXONTWBENEK-UHFFFAOYSA-N.
| Molecular formula | C27H33N3O6S3 |
|---|---|
| Molecular weight | 591.8 g/mol |
| IUPAC name | 1,4,7-tris-(4-methylphenyl)sulfonyl-1,4,7-triazonane |
| InChIKey | BLZOXONTWBENEK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCN(CCN(CC2)S(=O)(=O)C3=CC=C(C=C3)C)S(=O)(=O)C4=CC=C(C=C4)C |
Computed by PubChem (NCBI)