CAS 5267-23-2 appears in our catalog under these names: 2,4-Dinitro-5-methylphenylhydrazine, 95%, 2,4-Dinitro-5-methylphenylhydrazine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 1000mg, 500mg.
(5-methyl-2,4-dinitrophenyl)hydrazine (CAS 5267-23-2) is a chemical compound with the molecular formula C7H8N4O4 and a molecular weight of 212.16 g/mol. IUPAC name: (5-methyl-2,4-dinitrophenyl)hydrazine. InChIKey: YBLLLDQIYSHJCB-UHFFFAOYSA-N.
| Molecular formula | C7H8N4O4 |
|---|---|
| Molecular weight | 212.16 g/mol |
| IUPAC name | (5-methyl-2,4-dinitrophenyl)hydrazine |
| InChIKey | YBLLLDQIYSHJCB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])NN |
Computed by PubChem (NCBI)