CAS 527-21-9 appears in our catalog under these names: 2,3,5,6–Tetrafluorocyclohexa–2,5–diene–1,4–dione, Tetrafluoro-1,4-benzoquinone, Tetrafluoro-1,4-benzoquinone, >98.0%(HPLC)(T), Tetrafluoro-1,4-benzoquinone 98%, TETRAFLUORO-1,4-BENZOQUINONE, 97%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 25g, 5g, 2g, 10g, 250mg, 100g.
2,3,5,6-tetrafluorocyclohexa-2,5-diene-1,4-dione (CAS 527-21-9) is a chemical compound with the molecular formula C6F4O2 and a molecular weight of 180.06 g/mol. IUPAC name: 2,3,5,6-tetrafluorocyclohexa-2,5-diene-1,4-dione. InChIKey: JKLYZOGJWVAIQS-UHFFFAOYSA-N.
| Molecular formula | C6F4O2 |
|---|---|
| Molecular weight | 180.06 g/mol |
| IUPAC name | 2,3,5,6-tetrafluorocyclohexa-2,5-diene-1,4-dione |
| InChIKey | JKLYZOGJWVAIQS-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=O)C(=C(C1=O)F)F)F)F |
Computed by PubChem (NCBI)