CAS 52702-51-9 appears in our catalog under these names: Dembrexine hydrochloride monohydrate, Dembrexine Hydrochloride, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2,4-dibromo-6-[[(4-hydroxycyclohexyl)amino]methyl]phenol;hydrochloride (CAS 52702-51-9) is a chemical compound with the molecular formula C13H18Br2ClNO2 and a molecular weight of 415.55 g/mol. IUPAC name: 2,4-dibromo-6-[[(4-hydroxycyclohexyl)amino]methyl]phenol;hydrochloride. InChIKey: BGRWLVRJIPTKQW-UHFFFAOYSA-N.
| Molecular formula | C13H18Br2ClNO2 |
|---|---|
| Molecular weight | 415.55 g/mol |
| IUPAC name | 2,4-dibromo-6-[[(4-hydroxycyclohexyl)amino]methyl]phenol;hydrochloride |
| InChIKey | BGRWLVRJIPTKQW-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1NCC2=C(C(=CC(=C2)Br)Br)O)O.Cl |
Computed by PubChem (NCBI)