Products 52704-70-8

CAS 52704-70-8 is the registry number for PCB 134, ROTI®Star, 5 mg, glass. Offered by: Roth. Available pack sizes: 5mg.

Structural formula: {0} (CAS {1})

1,2,4,5-tetrachloro-3-(2,3-dichlorophenyl)benzene (CAS 52704-70-8) is a chemical compound with the molecular formula C12H4Cl6 and a molecular weight of 360.9 g/mol. IUPAC name: 1,2,4,5-tetrachloro-3-(2,3-dichlorophenyl)benzene. InChIKey: RVWLHPJFOKUPNM-UHFFFAOYSA-N.

Identity
Molecular formulaC12H4Cl6
Molecular weight360.9 g/mol
IUPAC name1,2,4,5-tetrachloro-3-(2,3-dichlorophenyl)benzene
InChIKeyRVWLHPJFOKUPNM-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)Cl)Cl)C2=C(C(=CC(=C2Cl)Cl)Cl)Cl

Computed by PubChem (NCBI)