CAS 52711-99-6 is the registry number for 5-Naphthyltetracene. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
5-naphthalen-1-yltetracene (CAS 52711-99-6) is a chemical compound with the molecular formula C28H18 and a molecular weight of 354.4 g/mol. IUPAC name: 5-naphthalen-1-yltetracene. InChIKey: KVFLHHQOWFQZDW-UHFFFAOYSA-N.
| Molecular formula | C28H18 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 5-naphthalen-1-yltetracene |
| InChIKey | KVFLHHQOWFQZDW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=C4C=CC=CC4=CC5=CC6=CC=CC=C6C=C53 |
Computed by PubChem (NCBI)