CAS 52723-61-2 is the registry number for Zincfumarate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Zinc (E)-but-2-enedioate (CAS 52723-61-2) is a chemical compound with the molecular formula C4H2O4Zn and a molecular weight of 179.4 g/mol. IUPAC name: zinc (E)-but-2-enedioate. InChIKey: HJSYJHHRQVHHMQ-TYYBGVCCSA-L.
| Molecular formula | C4H2O4Zn |
|---|---|
| Molecular weight | 179.4 g/mol |
| IUPAC name | zinc (E)-but-2-enedioate |
| InChIKey | HJSYJHHRQVHHMQ-TYYBGVCCSA-L |
| SMILES | C(=C/C(=O)[O-])\C(=O)[O-].[Zn+2] |
Computed by PubChem (NCBI)