Products 52730-40-2
CAS 52730-40-2 appears in our catalog under these names: (1R，2S，3S，4S，6R)–rel–5–Oxotricyclo(2·2·1·02，6)heptane–3–carboxylic Acid, Anti-3-oxotricyclo[2.2.1.0(2,6)]heptane-7-carboxylic acid, 95%, (1R，2S，3S，4S，6R)-rel-5-Oxotricyclo[2.2.1.02，6]heptane-3-carboxylic Acid, ≥95%, ≥95%. Offered by: GLPBio, Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g, 25g.
(1R,2R,3S,4S,6R)-5-oxotricyclo[2.2.1.02,6]heptane-3-carboxylic acid (CAS 52730-40-2) is a chemical compound with the molecular formula C8H8O3 and a molecular weight of 152.15 g/mol. IUPAC name: (1R,2R,3S,4S,6R)-5-oxotricyclo[2.2.1.02,6]heptane-3-carboxylic acid. InChIKey: YUOZAHBGIJALKD-AIECOIEWSA-N.
| Molecular formula | C8H8O3 |
|---|---|
| Molecular weight | 152.15 g/mol |
| IUPAC name | (1R,2R,3S,4S,6R)-5-oxotricyclo[2.2.1.02,6]heptane-3-carboxylic acid |
| InChIKey | YUOZAHBGIJALKD-AIECOIEWSA-N |
| SMILES | C1[C@@H]2[C@@H]3[C@@H]2C(=O)[C@@H]1[C@H]3C(=O)O |
Computed by PubChem (NCBI)