CAS 52756-22-6 appears in our catalog under these names: Flamprop-isopropyl, Flamprop-isopropyl 10 µg/mL in Cyclohexane, Flamprop-isopropyl, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 1g, 250mg, 10ml, 1x5ml.
Propan-2-yl 2-(N-benzoyl-3-chloro-4-fluoroanilino)propanoate (CAS 52756-22-6) is a chemical compound with the molecular formula C19H19ClFNO3 and a molecular weight of 363.8 g/mol. IUPAC name: propan-2-yl 2-(N-benzoyl-3-chloro-4-fluoroanilino)propanoate. InChIKey: IKVXBIIHQGXQRQ-UHFFFAOYSA-N.
| Molecular formula | C19H19ClFNO3 |
|---|---|
| Molecular weight | 363.8 g/mol |
| IUPAC name | propan-2-yl 2-(N-benzoyl-3-chloro-4-fluoroanilino)propanoate |
| InChIKey | IKVXBIIHQGXQRQ-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C(C)N(C1=CC(=C(C=C1)F)Cl)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)