CAS 52756-25-9 appears in our catalog under these names: Flamprop-methyl, Flamprop-methyl, Concentration: 100 µg/ml Solvent: Acetonitrile, Flamprop-methyl, Concentration: 10.0 µg/ml Solvent: Acetonitrile, Flamprop-methyl (Standard). Offered by: TRC, Dr. Ehrenstorfer, HPC Standards, MedChemExpress. Available pack sizes: 1g, 100mg, 1x5ml, 1x10ml, Get quote.
Methyl 2-(N-benzoyl-3-chloro-4-fluoroanilino)propanoate (CAS 52756-25-9) is a chemical compound with the molecular formula C17H15ClFNO3 and a molecular weight of 335.8 g/mol. IUPAC name: methyl 2-(N-benzoyl-3-chloro-4-fluoroanilino)propanoate. InChIKey: RBNIGDFIUWJJEV-UHFFFAOYSA-N.
| Molecular formula | C17H15ClFNO3 |
|---|---|
| Molecular weight | 335.8 g/mol |
| IUPAC name | methyl 2-(N-benzoyl-3-chloro-4-fluoroanilino)propanoate |
| InChIKey | RBNIGDFIUWJJEV-UHFFFAOYSA-N |
| SMILES | CC(C(=O)OC)N(C1=CC(=C(C=C1)F)Cl)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)